C14H20IN2O- — CID 163941327
(3S)-N-butyliodanuidyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 163941327) has the molecular formula C14H20IN2O- and a molecular weight of 359.23 g/mol. Its IUPAC name is (3S)-N-butyliodanuidyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3S)-N-butyliodanuidyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 163941327 |
| Molecular Formula | C14H20IN2O- |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | (3S)-N-butyliodanuidyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | CCCC[I-]NC(=O)[C@@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C14H20IN2O/c1-2-3-8-15-17-14(18)13-9-11-6-4-5-7-12(11)10-16-13/h4-7,13,16H,2-3,8-10H2,1H3,(H,17,18)/q-1/t13-/m0/s1 |
| InChIKey | ZEIOOBFBOANTLG-ZDUSSCGKSA-N |
| XLogP | -1.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|