C15H27N3O — CID 163942495
N-[(3Z)-5-[3-(ethylamino)propyl-propylamino]hexa-1,3,5-trien-2-yl]formamide (PubChem CID 163942495) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is N-[(3Z)-5-[3-(ethylamino)propyl-propylamino]hexa-1,3,5-trien-2-yl]formamide.
| Compound Name | N-[(3Z)-5-[3-(ethylamino)propyl-propylamino]hexa-1,3,5-trien-2-yl]formamide |
|---|---|
| PubChem CID | 163942495 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | N-[(3Z)-5-[3-(ethylamino)propyl-propylamino]hexa-1,3,5-trien-2-yl]formamide |
| SMILES | C=C(/C=C\C(=C)N(CCC)CCCNCC)NC=O |
| InChI | InChI=1S/C15H27N3O/c1-5-11-18(12-7-10-16-6-2)15(4)9-8-14(3)17-13-19/h8-9,13,16H,3-7,10-12H2,1-2H3,(H,17,19)/b9-8- |
| InChIKey | RSFJGFMHAIXIMY-HJWRWDBZSA-N |
| XLogP | 2.03 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|