C18H36NO3+ — CID 163942541
(3,3,10,10-tetraethyl-8,8-dimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl)oxidanium (PubChem CID 163942541) has the molecular formula C18H36NO3+ and a molecular weight of 314.49 g/mol. Its IUPAC name is (3,3,10,10-tetraethyl-8,8-dimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl)oxidanium.
| Compound Name | (3,3,10,10-tetraethyl-8,8-dimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl)oxidanium |
|---|---|
| PubChem CID | 163942541 |
| Molecular Formula | C18H36NO3+ |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | (3,3,10,10-tetraethyl-8,8-dimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl)oxidanium |
| SMILES | CCC1(CC)COC2(CC(C)(C)N([OH2+])C(CC)(CC)C2)OC1 |
| InChI | InChI=1S/C18H35NO3/c1-7-16(8-2)13-21-18(22-14-16)11-15(5,6)19(20)17(9-3,10-4)12-18/h20H,7-14H2,1-6H3/p+1 |
| InChIKey | RSGLGFXUVGNOFM-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 44.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|