C18H17ClF3NO3 — CID 163942617
5-(4-chlorophenyl)-N-hydroxy-3-methoxy-4-(3,4,5-trifluorophenyl)pentanamide (PubChem CID 163942617) has the molecular formula C18H17ClF3NO3 and a molecular weight of 387.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-hydroxy-3-methoxy-4-(3,4,5-trifluorophenyl)pentanamide.
| Compound Name | 5-(4-chlorophenyl)-N-hydroxy-3-methoxy-4-(3,4,5-trifluorophenyl)pentanamide |
|---|---|
| PubChem CID | 163942617 |
| Molecular Formula | C18H17ClF3NO3 |
| Molecular Weight | 387.79 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 5-(4-chlorophenyl)-N-hydroxy-3-methoxy-4-(3,4,5-trifluorophenyl)pentanamide |
| SMILES | COC(CC(=O)NO)C(Cc1ccc(Cl)cc1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C18H17ClF3NO3/c1-26-16(9-17(24)23-25)13(6-10-2-4-12(19)5-3-10)11-7-14(20)18(22)15(21)8-11/h2-5,7-8,13,16,25H,6,9H2,1H3,(H,23,24) |
| InChIKey | RSIFUVAUUCSYGB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.79 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|