About 4-chloro-2-iodo-1,3-oxazole
4-chloro-2-iodo-1,3-oxazole (PubChem CID 163942624) has the molecular formula C3HClINO
and a molecular weight of 229.40 g/mol. Its IUPAC name is 4-chloro-2-iodo-1,3-oxazole.
Molecular Properties
| Compound Name | 4-chloro-2-iodo-1,3-oxazole |
| PubChem CID | 163942624 |
| Molecular Formula | C3HClINO |
| Molecular Weight | 229.40 g/mol |
| Exact Mass | 228.88 |
| IUPAC Name | 4-chloro-2-iodo-1,3-oxazole |
| SMILES | Clc1coc(I)n1 |
| InChI | InChI=1S/C3HClINO/c4-2-1-7-3(5)6-2/h1H |
| InChIKey | RSIKKGNRVZVNON-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-iodo-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-iodo-1,3-oxazole?
The IUPAC name of 4-chloro-2-iodo-1,3-oxazole (CID 163942624) is 4-chloro-2-iodo-1,3-oxazole.
What is the SMILES notation for 4-chloro-2-iodo-1,3-oxazole?
The canonical SMILES for 4-chloro-2-iodo-1,3-oxazole is Clc1coc(I)n1.
What is the InChIKey of 4-chloro-2-iodo-1,3-oxazole?
The InChIKey is RSIKKGNRVZVNON-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HClINO/c4-2-1-7-3(5)6-2/h1H.
What are the key properties of 4-chloro-2-iodo-1,3-oxazole?
4-chloro-2-iodo-1,3-oxazole has a molecular weight of 229.40 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-iodo-1,3-oxazole is sourced from PubChem (CID 163942624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).