C7H22N6S — CID 163942684
1-(aminomethyl)-1-methylthiane-2,3,4,5,6-pentamine (PubChem CID 163942684) has the molecular formula C7H22N6S and a molecular weight of 222.36 g/mol. Its IUPAC name is 1-(aminomethyl)-1-methylthiane-2,3,4,5,6-pentamine.
| Compound Name | 1-(aminomethyl)-1-methylthiane-2,3,4,5,6-pentamine |
|---|---|
| PubChem CID | 163942684 |
| Molecular Formula | C7H22N6S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-(aminomethyl)-1-methylthiane-2,3,4,5,6-pentamine |
| SMILES | CS1(CN)C(N)C(N)C(N)C(N)C1N |
| InChI | InChI=1S/C7H22N6S/c1-14(2-8)6(12)4(10)3(9)5(11)7(14)13/h3-7H,2,8-13H2,1H3 |
| InChIKey | RSJJTZGBROQBFX-UHFFFAOYSA-N |
| XLogP | -3.10 |
| TPSA | 156.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |