C17H20N6S — CID 163943791
5-[4-(azetidin-1-yl-imino-methylidene-λ6-sulfanyl)-2-methylphenyl]-1H-pyrazolo[4,3-b]pyridin-3-amine (PubChem CID 163943791) has the molecular formula C17H20N6S and a molecular weight of 340.46 g/mol. Its IUPAC name is 5-[4-(azetidin-1-yl-imino-methylidene-λ6-sulfanyl)-2-methylphenyl]-1H-pyrazolo[4,3-b]pyridin-3-amine.
| Compound Name | 5-[4-(azetidin-1-yl-imino-methylidene-λ6-sulfanyl)-2-methylphenyl]-1H-pyrazolo[4,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 163943791 |
| Molecular Formula | C17H20N6S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 5-[4-(azetidin-1-yl-imino-methylidene-λ6-sulfanyl)-2-methylphenyl]-1H-pyrazolo[4,3-b]pyridin-3-amine |
| SMILES | [H]N=S(=C)(c1ccc(-c2ccc3[nH]nc(N)c3n2)c(C)c1)N1CCC1 |
| InChI | InChI=1S/C17H20N6S/c1-11-10-12(24(2,19)23-8-3-9-23)4-5-13(11)14-6-7-15-16(20-14)17(18)22-21-15/h4-7,10,19H,2-3,8-9H2,1H3,(H3,18,21,22) |
| InChIKey | RTIIHHIHLSLBOD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|