C19H15ClN4O2 — CID 163943855
2-chloro-4-[[(1R,2S)-2-hydroxy-1-(5-phenyl-1,3,4-oxadiazol-2-yl)but-3-enyl]amino]benzonitrile (PubChem CID 163943855) has the molecular formula C19H15ClN4O2 and a molecular weight of 366.81 g/mol. Its IUPAC name is 2-chloro-4-[[(1R,2S)-2-hydroxy-1-(5-phenyl-1,3,4-oxadiazol-2-yl)but-3-enyl]amino]benzonitrile.
| Compound Name | 2-chloro-4-[[(1R,2S)-2-hydroxy-1-(5-phenyl-1,3,4-oxadiazol-2-yl)but-3-enyl]amino]benzonitrile |
|---|---|
| PubChem CID | 163943855 |
| Molecular Formula | C19H15ClN4O2 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-chloro-4-[[(1R,2S)-2-hydroxy-1-(5-phenyl-1,3,4-oxadiazol-2-yl)but-3-enyl]amino]benzonitrile |
| SMILES | C=C[C@H](O)[C@@H](Nc1ccc(C#N)c(Cl)c1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C19H15ClN4O2/c1-2-16(25)17(22-14-9-8-13(11-21)15(20)10-14)19-24-23-18(26-19)12-6-4-3-5-7-12/h2-10,16-17,22,25H,1H2/t16-,17+/m0/s1 |
| InChIKey | RTJRQBZIEFZDOA-DLBZAZTESA-N |
| XLogP | 3.96 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|