C17H14F2IN5O2 — CID 163943894
N-[3-(2-amino-1-iodo-4-methyl-6-oxo-5H-pyrimidin-4-yl)-4-fluorophenyl]-3-fluoropyridine-2-carboxamide (PubChem CID 163943894) has the molecular formula C17H14F2IN5O2 and a molecular weight of 485.23 g/mol. Its IUPAC name is N-[3-(2-amino-1-iodo-4-methyl-6-oxo-5H-pyrimidin-4-yl)-4-fluorophenyl]-3-fluoropyridine-2-carboxamide.
| Compound Name | N-[3-(2-amino-1-iodo-4-methyl-6-oxo-5H-pyrimidin-4-yl)-4-fluorophenyl]-3-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 163943894 |
| Molecular Formula | C17H14F2IN5O2 |
| Molecular Weight | 485.23 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | N-[3-(2-amino-1-iodo-4-methyl-6-oxo-5H-pyrimidin-4-yl)-4-fluorophenyl]-3-fluoropyridine-2-carboxamide |
| SMILES | CC1(c2cc(NC(=O)c3ncccc3F)ccc2F)CC(=O)N(I)C(N)=N1 |
| InChI | InChI=1S/C17H14F2IN5O2/c1-17(8-13(26)25(20)16(21)24-17)10-7-9(4-5-11(10)18)23-15(27)14-12(19)3-2-6-22-14/h2-7H,8H2,1H3,(H2,21,24)(H,23,27) |
| InChIKey | RTKLAJFKTYUERM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|