C30H35N2S+ — CID 163944143
4-[1-[[2-(4-cyclohexa-2,4-dien-1-ylcyclohexa-2,4-dien-1-yl)-5-phenylcyclohexa-1,3-dien-1-yl]amino]aziridin-1-ium-2-yl]but-3-ene-1-thiol (PubChem CID 163944143) has the molecular formula C30H35N2S+ and a molecular weight of 455.69 g/mol. Its IUPAC name is 4-[1-[[2-(4-cyclohexa-2,4-dien-1-ylcyclohexa-2,4-dien-1-yl)-5-phenylcyclohexa-1,3-dien-1-yl]amino]aziridin-1-ium-2-yl]but-3-ene-1-thiol.
| Compound Name | 4-[1-[[2-(4-cyclohexa-2,4-dien-1-ylcyclohexa-2,4-dien-1-yl)-5-phenylcyclohexa-1,3-dien-1-yl]amino]aziridin-1-ium-2-yl]but-3-ene-1-thiol |
|---|---|
| PubChem CID | 163944143 |
| Molecular Formula | C30H35N2S+ |
| Molecular Weight | 455.69 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 4-[1-[[2-(4-cyclohexa-2,4-dien-1-ylcyclohexa-2,4-dien-1-yl)-5-phenylcyclohexa-1,3-dien-1-yl]amino]aziridin-1-ium-2-yl]but-3-ene-1-thiol |
| SMILES | SCCC=CC1C[NH+]1NC1=C(C2C=CC(C3C=CC=CC3)=CC2)C=CC(c2ccccc2)C1 |
| InChI | InChI=1S/C30H34N2S/c33-20-8-7-13-28-22-32(28)31-30-21-27(24-11-5-2-6-12-24)18-19-29(30)26-16-14-25(15-17-26)23-9-3-1-4-10-23/h1-7,9,11-16,18-19,23,26-28,31,33H,8,10,17,20-22H2/p+1 |
| InChIKey | RTPQXRHVKDNELF-UHFFFAOYSA-O |
| XLogP | 5.27 |
| TPSA | 16.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.69 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|