About (Z)-1-iminohept-3-ene-2,6-dione
(Z)-1-iminohept-3-ene-2,6-dione (PubChem CID 163944688) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is (Z)-1-iminohept-3-ene-2,6-dione.
Molecular Properties
| Compound Name | (Z)-1-iminohept-3-ene-2,6-dione |
| PubChem CID | 163944688 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (Z)-1-iminohept-3-ene-2,6-dione |
| SMILES | [H]/N=C/C(=O)/C=C\CC(C)=O |
| InChI | InChI=1S/C7H9NO2/c1-6(9)3-2-4-7(10)5-8/h2,4-5,8H,3H2,1H3/b4-2-,8-5+ |
| InChIKey | RUBJNZOKRJQTAZ-BTPMFQHTSA-N |
| XLogP | 0.74 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-iminohept-3-ene-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-iminohept-3-ene-2,6-dione?
The IUPAC name of (Z)-1-iminohept-3-ene-2,6-dione (CID 163944688) is (Z)-1-iminohept-3-ene-2,6-dione.
What is the SMILES notation for (Z)-1-iminohept-3-ene-2,6-dione?
The canonical SMILES for (Z)-1-iminohept-3-ene-2,6-dione is [H]/N=C/C(=O)/C=C\CC(C)=O.
What is the InChIKey of (Z)-1-iminohept-3-ene-2,6-dione?
The InChIKey is RUBJNZOKRJQTAZ-BTPMFQHTSA-N. The full InChI is InChI=1S/C7H9NO2/c1-6(9)3-2-4-7(10)5-8/h2,4-5,8H,3H2,1H3/b4-2-,8-5+.
What are the key properties of (Z)-1-iminohept-3-ene-2,6-dione?
(Z)-1-iminohept-3-ene-2,6-dione has a molecular weight of 139.15 g/mol, XLogP of 0.74, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-iminohept-3-ene-2,6-dione is sourced from PubChem (CID 163944688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).