C16H30N2 — CID 163944725
2-[(2-ethylcyclohexa-2,4-dien-1-yl)methyl]-N',2-dimethylpentane-1,5-diamine (PubChem CID 163944725) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 2-[(2-ethylcyclohexa-2,4-dien-1-yl)methyl]-N',2-dimethylpentane-1,5-diamine.
| Compound Name | 2-[(2-ethylcyclohexa-2,4-dien-1-yl)methyl]-N',2-dimethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 163944725 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 2-[(2-ethylcyclohexa-2,4-dien-1-yl)methyl]-N',2-dimethylpentane-1,5-diamine |
| SMILES | CCC1=CC=CCC1CC(C)(CN)CCCNC |
| InChI | InChI=1S/C16H30N2/c1-4-14-8-5-6-9-15(14)12-16(2,13-17)10-7-11-18-3/h5-6,8,15,18H,4,7,9-13,17H2,1-3H3 |
| InChIKey | RUCDUIIVTPTLNK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|