C8H14N2O — CID 163944783
N-(5-methyl-1,2,3,6-tetrahydropyridin-3-yl)acetamide (PubChem CID 163944783) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is N-(5-methyl-1,2,3,6-tetrahydropyridin-3-yl)acetamide.
| Compound Name | N-(5-methyl-1,2,3,6-tetrahydropyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 163944783 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | N-(5-methyl-1,2,3,6-tetrahydropyridin-3-yl)acetamide |
| SMILES | CC(=O)NC1C=C(C)CNC1 |
| InChI | InChI=1S/C8H14N2O/c1-6-3-8(5-9-4-6)10-7(2)11/h3,8-9H,4-5H2,1-2H3,(H,10,11) |
| InChIKey | RUDIXJZLAGONAY-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|