About [methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate
[methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate (PubChem CID 163945586) has the molecular formula C18H27NO4
and a molecular weight of 321.42 g/mol. Its IUPAC name is [methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | [methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate |
| PubChem CID | 163945586 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | [methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate |
| SMILES | CC[C@H](C(=O)OCOC(=O)N(C)c1ccc(C)cc1)C(C)(C)C |
| InChI | InChI=1S/C18H27NO4/c1-7-15(18(3,4)5)16(20)22-12-23-17(21)19(6)14-10-8-13(2)9-11-14/h8-11,15H,7,12H2,1-6H3/t15-/m1/s1 |
| InChIKey | AZPOEZHBJYRWOF-OAHLLOKOSA-N |
| XLogP | 4.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate?
The IUPAC name of [methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate (CID 163945586) is [methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate.
What is the SMILES notation for [methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate?
The canonical SMILES for [methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate is CC[C@H](C(=O)OCOC(=O)N(C)c1ccc(C)cc1)C(C)(C)C.
What is the InChIKey of [methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate?
The InChIKey is AZPOEZHBJYRWOF-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H27NO4/c1-7-15(18(3,4)5)16(20)22-12-23-17(21)19(6)14-10-8-13(2)9-11-14/h8-11,15H,7,12H2,1-6H3/t15-/m1/s1.
What are the key properties of [methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate?
[methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate has a molecular weight of 321.42 g/mol, XLogP of 4.14, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl-(4-methylphenyl)carbamoyl]oxymethyl (2S)-2-ethyl-3,3-dimethylbutanoate is sourced from PubChem (CID 163945586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).