C12H12O2 — CID 163948359
2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-carbaldehyde (PubChem CID 163948359) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-carbaldehyde.
| Compound Name | 2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-carbaldehyde |
|---|---|
| PubChem CID | 163948359 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-carbaldehyde |
| SMILES | O=CC1CCc2ccc3c(c21)CCO3 |
| InChI | InChI=1S/C12H12O2/c13-7-9-2-1-8-3-4-11-10(12(8)9)5-6-14-11/h3-4,7,9H,1-2,5-6H2 |
| InChIKey | RXDJBNQSMWVKFD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|