About 1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one
1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one (PubChem CID 163948422) has the molecular formula C11H21FN2O
and a molecular weight of 216.30 g/mol. Its IUPAC name is 1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one.
Molecular Properties
| Compound Name | 1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one |
| PubChem CID | 163948422 |
| Molecular Formula | C11H21FN2O |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one |
| SMILES | CC(=O)CN[C@@H]1C[C@H](C)CN(C(C)F)C1 |
| InChI | InChI=1S/C11H21FN2O/c1-8-4-11(13-5-9(2)15)7-14(6-8)10(3)12/h8,10-11,13H,4-7H2,1-3H3/t8-,10?,11+/m0/s1 |
| InChIKey | RXEMNFLVDAZWAO-UMYMBVSISA-N |
| XLogP | 1.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one?
The IUPAC name of 1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one (CID 163948422) is 1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one.
What is the SMILES notation for 1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one?
The canonical SMILES for 1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one is CC(=O)CN[C@@H]1C[C@H](C)CN(C(C)F)C1.
What is the InChIKey of 1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one?
The InChIKey is RXEMNFLVDAZWAO-UMYMBVSISA-N. The full InChI is InChI=1S/C11H21FN2O/c1-8-4-11(13-5-9(2)15)7-14(6-8)10(3)12/h8,10-11,13H,4-7H2,1-3H3/t8-,10?,11+/m0/s1.
What are the key properties of 1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one?
1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one has a molecular weight of 216.30 g/mol, XLogP of 1.19, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(3R,5S)-1-(1-fluoroethyl)-5-methylpiperidin-3-yl]amino]propan-2-one is sourced from PubChem (CID 163948422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).