About (7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate
(7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate (PubChem CID 163948547) has the molecular formula C11H16O5
and a molecular weight of 228.24 g/mol. Its IUPAC name is (7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate.
Molecular Properties
| Compound Name | (7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate |
| PubChem CID | 163948547 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1C2CC(=O)OC1C(C)O2 |
| InChI | InChI=1S/C11H16O5/c1-5(2)11(13)16-10-7-4-8(12)15-9(10)6(3)14-7/h5-7,9-10H,4H2,1-3H3 |
| InChIKey | RXHDEEUTQDIYCO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate?
The IUPAC name of (7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate (CID 163948547) is (7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate.
What is the SMILES notation for (7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate?
The canonical SMILES for (7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate is CC(C)C(=O)OC1C2CC(=O)OC1C(C)O2.
What is the InChIKey of (7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate?
The InChIKey is RXHDEEUTQDIYCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O5/c1-5(2)11(13)16-10-7-4-8(12)15-9(10)6(3)14-7/h5-7,9-10H,4H2,1-3H3.
What are the key properties of (7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate?
(7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate has a molecular weight of 228.24 g/mol, XLogP of 0.66, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methyl-3-oxo-2,6-dioxabicyclo[3.2.1]octan-8-yl) 2-methylpropanoate is sourced from PubChem (CID 163948547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).