C6H7F7N2O7S3 — CID 163948958
2-fluoro-N-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonylacetamide (PubChem CID 163948958) has the molecular formula C6H7F7N2O7S3 and a molecular weight of 448.32 g/mol. Its IUPAC name is 2-fluoro-N-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonylacetamide.
| Compound Name | 2-fluoro-N-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonylacetamide |
|---|---|
| PubChem CID | 163948958 |
| Molecular Formula | C6H7F7N2O7S3 |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.93 |
| IUPAC Name | 2-fluoro-N-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonylacetamide |
| SMILES | CS(=O)(=O)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NC(=O)CF |
| InChI | InChI=1S/C6H7F7N2O7S3/c1-23(17,18)15-25(21,22)6(12,13)4(8,9)5(10,11)24(19,20)14-3(16)2-7/h15H,2H2,1H3,(H,14,16) |
| InChIKey | HTWJRDMDHMULOT-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|