About 2,3,4-trifluoro-N-methylcyclohexa-1,5-dien-1-amine
2,3,4-trifluoro-N-methylcyclohexa-1,5-dien-1-amine (PubChem CID 163949932) has the molecular formula C7H8F3N
and a molecular weight of 163.14 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-methylcyclohexa-1,5-dien-1-amine.
Analyze 2,3,4-trifluoro-N-methylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-trifluoro-N-methylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 2,3,4-trifluoro-N-methylcyclohexa-1,5-dien-1-amine (CID 163949932) is 2,3,4-trifluoro-N-methylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 2,3,4-trifluoro-N-methylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 2,3,4-trifluoro-N-methylcyclohexa-1,5-dien-1-amine is CNC1=C(F)C(F)C(F)C=C1.
What is the InChIKey of 2,3,4-trifluoro-N-methylcyclohexa-1,5-dien-1-amine?
The InChIKey is RYKNUIYTRCJYAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N/c1-11-5-3-2-4(8)6(9)7(5)10/h2-4,6,11H,1H3.
What are the key properties of 2,3,4-trifluoro-N-methylcyclohexa-1,5-dien-1-amine?
2,3,4-trifluoro-N-methylcyclohexa-1,5-dien-1-amine has a molecular weight of 163.14 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-trifluoro-N-methylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 163949932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).