C10H16O3 — CID 163950509
1-[(1R,4S,5S,7S,8S)-4,8-dimethyl-2,6-dioxabicyclo[3.2.1]octan-7-yl]ethanone (PubChem CID 163950509) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 1-[(1R,4S,5S,7S,8S)-4,8-dimethyl-2,6-dioxabicyclo[3.2.1]octan-7-yl]ethanone.
| Compound Name | 1-[(1R,4S,5S,7S,8S)-4,8-dimethyl-2,6-dioxabicyclo[3.2.1]octan-7-yl]ethanone |
|---|---|
| PubChem CID | 163950509 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 1-[(1R,4S,5S,7S,8S)-4,8-dimethyl-2,6-dioxabicyclo[3.2.1]octan-7-yl]ethanone |
| SMILES | CC(=O)[C@H]1O[C@@H]2[C@H](C)[C@H]1OC[C@@H]2C |
| InChI | InChI=1S/C10H16O3/c1-5-4-12-9-6(2)8(5)13-10(9)7(3)11/h5-6,8-10H,4H2,1-3H3/t5-,6-,8-,9+,10+/m0/s1 |
| InChIKey | RYXATUZNJFMULL-BZQIZSTOSA-N |
| XLogP | 1.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |