C12H22NOU- — CID 163950533
(E,2S)-5-[(2R)-1,2-dimethylpyrrolidin-5-id-2-yl]-3-methylpent-3-en-2-ol;uranium (PubChem CID 163950533) has the molecular formula C12H22NOU- and a molecular weight of 434.34 g/mol. Its IUPAC name is (E,2S)-5-[(2R)-1,2-dimethylpyrrolidin-5-id-2-yl]-3-methylpent-3-en-2-ol;uranium.
| Compound Name | (E,2S)-5-[(2R)-1,2-dimethylpyrrolidin-5-id-2-yl]-3-methylpent-3-en-2-ol;uranium |
|---|---|
| PubChem CID | 163950533 |
| Molecular Formula | C12H22NOU- |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (E,2S)-5-[(2R)-1,2-dimethylpyrrolidin-5-id-2-yl]-3-methylpent-3-en-2-ol;uranium |
| SMILES | C/C(=C\C[C@@]1(C)CC[CH-]N1C)[C@H](C)O.[U] |
| InChI | InChI=1S/C12H22NO.U/c1-10(11(2)14)6-8-12(3)7-5-9-13(12)4;/h6,9,11,14H,5,7-8H2,1-4H3;/q-1;/b10-6+;/t11-,12+;/m0./s1 |
| InChIKey | YIUYIAIYDNYICV-XXULMBIVSA-N |
| XLogP | 2.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|