C16H28N6O4P+ — CID 163950962
8-[[1-[di(propan-2-yloxy)phosphorylmethoxy]cyclopropyl]methyl]-6H-pyrazolo[1,5-a][1,3,5]triazin-5-ium-2,4-diamine (PubChem CID 163950962) has the molecular formula C16H28N6O4P+ and a molecular weight of 399.41 g/mol. Its IUPAC name is 8-[[1-[di(propan-2-yloxy)phosphorylmethoxy]cyclopropyl]methyl]-6H-pyrazolo[1,5-a][1,3,5]triazin-5-ium-2,4-diamine.
| Compound Name | 8-[[1-[di(propan-2-yloxy)phosphorylmethoxy]cyclopropyl]methyl]-6H-pyrazolo[1,5-a][1,3,5]triazin-5-ium-2,4-diamine |
|---|---|
| PubChem CID | 163950962 |
| Molecular Formula | C16H28N6O4P+ |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 8-[[1-[di(propan-2-yloxy)phosphorylmethoxy]cyclopropyl]methyl]-6H-pyrazolo[1,5-a][1,3,5]triazin-5-ium-2,4-diamine |
| SMILES | CC(C)OP(=O)(COC1(Cc2c[nH][n+]3c(N)nc(N)nc23)CC1)OC(C)C |
| InChI | InChI=1S/C16H27N6O4P/c1-10(2)25-27(23,26-11(3)4)9-24-16(5-6-16)7-12-8-19-22-13(12)20-14(17)21-15(22)18/h8,10-11H,5-7,9H2,1-4H3,(H4,17,18,19,20,21)/p+1 |
| InChIKey | FUXVGZZODSDDAO-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|