About 1-N'-methyl-3-N'-(methylamino)propanediimidamide
1-N'-methyl-3-N'-(methylamino)propanediimidamide (PubChem CID 163951189) has the molecular formula C5H13N5
and a molecular weight of 143.19 g/mol. Its IUPAC name is 1-N'-methyl-3-N'-(methylamino)propanediimidamide.
Molecular Properties
| Compound Name | 1-N'-methyl-3-N'-(methylamino)propanediimidamide |
| PubChem CID | 163951189 |
| Molecular Formula | C5H13N5 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.12 |
| IUPAC Name | 1-N'-methyl-3-N'-(methylamino)propanediimidamide |
| SMILES | C/N=C(\N)CC(N)=NNC |
| InChI | InChI=1S/C5H13N5/c1-8-4(6)3-5(7)10-9-2/h9H,3H2,1-2H3,(H2,6,8)(H2,7,10) |
| InChIKey | RZLOWGXOUNVESO-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-methyl-3-N'-(methylamino)propanediimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-methyl-3-N'-(methylamino)propanediimidamide?
The IUPAC name of 1-N'-methyl-3-N'-(methylamino)propanediimidamide (CID 163951189) is 1-N'-methyl-3-N'-(methylamino)propanediimidamide.
What is the SMILES notation for 1-N'-methyl-3-N'-(methylamino)propanediimidamide?
The canonical SMILES for 1-N'-methyl-3-N'-(methylamino)propanediimidamide is C/N=C(\N)CC(N)=NNC.
What is the InChIKey of 1-N'-methyl-3-N'-(methylamino)propanediimidamide?
The InChIKey is RZLOWGXOUNVESO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N5/c1-8-4(6)3-5(7)10-9-2/h9H,3H2,1-2H3,(H2,6,8)(H2,7,10).
What are the key properties of 1-N'-methyl-3-N'-(methylamino)propanediimidamide?
1-N'-methyl-3-N'-(methylamino)propanediimidamide has a molecular weight of 143.19 g/mol, XLogP of -1.14, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-methyl-3-N'-(methylamino)propanediimidamide is sourced from PubChem (CID 163951189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).