C14H23NO5 — CID 163952145
tert-butyl 5-(dihydroxymethylidene)-2-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 163952145) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is tert-butyl 5-(dihydroxymethylidene)-2-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 5-(dihydroxymethylidene)-2-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163952145 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | tert-butyl 5-(dihydroxymethylidene)-2-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CCC1CC(=C(O)O)N(C(=O)OC(C)(C)C)C1OC |
| InChI | InChI=1S/C14H23NO5/c1-6-7-9-8-10(12(16)17)15(11(9)19-5)13(18)20-14(2,3)4/h6,9,11,16-17H,1,7-8H2,2-5H3 |
| InChIKey | SAGIXFZTIWSMHX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|