C10H18N2O3 — CID 163952153
N',N'-diethyl-2-(2-hydroxyethyl)but-2-enediamide (PubChem CID 163952153) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is N',N'-diethyl-2-(2-hydroxyethyl)but-2-enediamide.
| Compound Name | N',N'-diethyl-2-(2-hydroxyethyl)but-2-enediamide |
|---|---|
| PubChem CID | 163952153 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | N',N'-diethyl-2-(2-hydroxyethyl)but-2-enediamide |
| SMILES | CCN(CC)C(=O)C=C(CCO)C(N)=O |
| InChI | InChI=1S/C10H18N2O3/c1-3-12(4-2)9(14)7-8(5-6-13)10(11)15/h7,13H,3-6H2,1-2H3,(H2,11,15) |
| InChIKey | JEUZZSQTILCMAL-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|