C16H25NOS — CID 163952231
(7E,11Z)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one (PubChem CID 163952231) has the molecular formula C16H25NOS and a molecular weight of 279.45 g/mol. Its IUPAC name is (7E,11Z)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one.
| Compound Name | (7E,11Z)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one |
|---|---|
| PubChem CID | 163952231 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (7E,11Z)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one |
| SMILES | C/C=C\CC/C(C)=C(\C)CC/C(=N\C)C(=S)C(C)=O |
| InChI | InChI=1S/C16H25NOS/c1-6-7-8-9-12(2)13(3)10-11-15(17-5)16(19)14(4)18/h6-7H,8-11H2,1-5H3/b7-6-,13-12+,17-15+ |
| InChIKey | SAICDHORLIMIQY-VXUFVNTOSA-N |
| XLogP | 4.49 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|