About hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole
hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole (PubChem CID 163952243) has the molecular formula C42H29N2-
and a molecular weight of 561.71 g/mol. Its IUPAC name is hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole.
Molecular Properties
| Compound Name | hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole |
| PubChem CID | 163952243 |
| Molecular Formula | C42H29N2- |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole |
| SMILES | [H-].c1ccc(-c2ccc(-n3c4ccccc4c4cc(-c5ccc6c(c5)c5ccccc5n6-c5ccccc5)ccc43)cc2)cc1 |
| InChI | InChI=1S/C42H28N2.H/c1-3-11-29(12-4-1)30-19-23-34(24-20-30)44-40-18-10-8-16-36(40)38-28-32(22-26-42(38)44)31-21-25-41-37(27-31)35-15-7-9-17-39(35)43(41)33-13-5-2-6-14-33;/h1-28H;/q;-1 |
| InChIKey | SAINIHRDZJYEQP-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole?
The IUPAC name of hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole (CID 163952243) is hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole.
What is the SMILES notation for hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole?
The canonical SMILES for hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole is [H-].c1ccc(-c2ccc(-n3c4ccccc4c4cc(-c5ccc6c(c5)c5ccccc5n6-c5ccccc5)ccc43)cc2)cc1.
What is the InChIKey of hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole?
The InChIKey is SAINIHRDZJYEQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H28N2.H/c1-3-11-29(12-4-1)30-19-23-34(24-20-30)44-40-18-10-8-16-36(40)38-28-32(22-26-42(38)44)31-21-25-41-37(27-31)35-15-7-9-17-39(35)43(41)33-13-5-2-6-14-33;/h1-28H;/q;-1.
What are the key properties of hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole?
hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole has a molecular weight of 561.71 g/mol, XLogP of 11.33, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydride;3-(9-phenylcarbazol-3-yl)-9-(4-phenylphenyl)carbazole is sourced from PubChem (CID 163952243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).