C13H22F2N2O — CID 163952641
(3S)-4-amino-N-[(Z,2S,3E)-3-ethylidene-6-fluorohex-4-en-2-yl]-3-fluoropentanamide (PubChem CID 163952641) has the molecular formula C13H22F2N2O and a molecular weight of 260.33 g/mol. Its IUPAC name is (3S)-4-amino-N-[(Z,2S,3E)-3-ethylidene-6-fluorohex-4-en-2-yl]-3-fluoropentanamide.
| Compound Name | (3S)-4-amino-N-[(Z,2S,3E)-3-ethylidene-6-fluorohex-4-en-2-yl]-3-fluoropentanamide |
|---|---|
| PubChem CID | 163952641 |
| Molecular Formula | C13H22F2N2O |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | (3S)-4-amino-N-[(Z,2S,3E)-3-ethylidene-6-fluorohex-4-en-2-yl]-3-fluoropentanamide |
| SMILES | C/C=C(\C=C/CF)[C@H](C)NC(=O)C[C@H](F)C(C)N |
| InChI | InChI=1S/C13H22F2N2O/c1-4-11(6-5-7-14)10(3)17-13(18)8-12(15)9(2)16/h4-6,9-10,12H,7-8,16H2,1-3H3,(H,17,18)/b6-5-,11-4+/t9?,10-,12-/m0/s1 |
| InChIKey | SAQKPTWPCQAAGR-DOXJCSFISA-N |
| XLogP | 2.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|