C26H22BrF9N2O3 — CID 163952746
1-[2-(4-bromo-4-methylcyclohexa-1,5-dien-1-yl)-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 163952746) has the molecular formula C26H22BrF9N2O3 and a molecular weight of 661.36 g/mol. Its IUPAC name is 1-[2-(4-bromo-4-methylcyclohexa-1,5-dien-1-yl)-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[2-(4-bromo-4-methylcyclohexa-1,5-dien-1-yl)-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 163952746 |
| Molecular Formula | C26H22BrF9N2O3 |
| Molecular Weight | 661.36 g/mol |
| Exact Mass | 660.07 |
| IUPAC Name | 1-[2-(4-bromo-4-methylcyclohexa-1,5-dien-1-yl)-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC1(Br)C=CC(CC(NC(=O)NCC(F)(F)F)(c2cccc(OC(F)(F)F)c2)c2cccc(OC(F)(F)F)c2)=CC1 |
| InChI | InChI=1S/C26H22BrF9N2O3/c1-22(27)10-8-16(9-11-22)14-23(38-21(39)37-15-24(28,29)30,17-4-2-6-19(12-17)40-25(31,32)33)18-5-3-7-20(13-18)41-26(34,35)36/h2-10,12-13H,11,14-15H2,1H3,(H2,37,38,39) |
| InChIKey | SASWXCBUDMNMEA-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.36 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|