C21H33FN2O2 — CID 163953121
tert-butyl N-[(2R)-2-(4-fluorocyclohex-3-en-1-yl)-1,2,4a,5,6,7,8,8a-octahydroquinolin-6-yl]-N-methylcarbamate (PubChem CID 163953121) has the molecular formula C21H33FN2O2 and a molecular weight of 364.51 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-(4-fluorocyclohex-3-en-1-yl)-1,2,4a,5,6,7,8,8a-octahydroquinolin-6-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2R)-2-(4-fluorocyclohex-3-en-1-yl)-1,2,4a,5,6,7,8,8a-octahydroquinolin-6-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 163953121 |
| Molecular Formula | C21H33FN2O2 |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | tert-butyl N-[(2R)-2-(4-fluorocyclohex-3-en-1-yl)-1,2,4a,5,6,7,8,8a-octahydroquinolin-6-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCC2N[C@H](C3CC=C(F)CC3)C=CC2C1 |
| InChI | InChI=1S/C21H33FN2O2/c1-21(2,3)26-20(25)24(4)17-10-12-19-15(13-17)7-11-18(23-19)14-5-8-16(22)9-6-14/h7-8,11,14-15,17-19,23H,5-6,9-10,12-13H2,1-4H3/t14?,15?,17?,18-,19?/m0/s1 |
| InChIKey | SBBATWZPJILGHK-LZWCOHLDSA-N |
| XLogP | 4.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|