C11H12N4 — CID 163953153
1-cyano-2-[(1E,3Z,6Z)-cyclonona-1,3,6,8-tetraen-1-yl]guanidine (PubChem CID 163953153) has the molecular formula C11H12N4 and a molecular weight of 200.24 g/mol. Its IUPAC name is 1-cyano-2-[(1E,3Z,6Z)-cyclonona-1,3,6,8-tetraen-1-yl]guanidine.
| Compound Name | 1-cyano-2-[(1E,3Z,6Z)-cyclonona-1,3,6,8-tetraen-1-yl]guanidine |
|---|---|
| PubChem CID | 163953153 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1-cyano-2-[(1E,3Z,6Z)-cyclonona-1,3,6,8-tetraen-1-yl]guanidine |
| SMILES | N#CN/C(N)=N/C1=C/C=C\C/C=C\C=C1 |
| InChI | InChI=1S/C11H12N4/c12-9-14-11(13)15-10-7-5-3-1-2-4-6-8-10/h1,3-8H,2H2,(H3,13,14,15)/b3-1-,6-4-,7-5?,10-8+ |
| InChIKey | SBBNRQFRKSMTPG-YNJLFCOJSA-N |
| XLogP | 1.33 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|