C11H16ClF3O — CID 163953461
(4Z,6E)-7-chloro-1,1,1-trifluoro-2,5-dimethylnona-4,6-dien-2-ol (PubChem CID 163953461) has the molecular formula C11H16ClF3O and a molecular weight of 256.69 g/mol. Its IUPAC name is (4Z,6E)-7-chloro-1,1,1-trifluoro-2,5-dimethylnona-4,6-dien-2-ol.
| Compound Name | (4Z,6E)-7-chloro-1,1,1-trifluoro-2,5-dimethylnona-4,6-dien-2-ol |
|---|---|
| PubChem CID | 163953461 |
| Molecular Formula | C11H16ClF3O |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (4Z,6E)-7-chloro-1,1,1-trifluoro-2,5-dimethylnona-4,6-dien-2-ol |
| SMILES | CC/C(Cl)=C\C(C)=C/CC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C11H16ClF3O/c1-4-9(12)7-8(2)5-6-10(3,16)11(13,14)15/h5,7,16H,4,6H2,1-3H3/b8-5-,9-7+ |
| InChIKey | SBIQPFKLRVGTRY-ANVCMGODSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|