C42H58F2IO4S- — CID 163953903
[4-[3-[(4-tert-butylphenyl)-methyl-phenyl-λ4-sulfanyl]phenyl]-8-(2,2-difluoropropanoyloxy)octyl] 5-methyl-2-methyliodanuidylhexanoate (PubChem CID 163953903) has the molecular formula C42H58F2IO4S- and a molecular weight of 823.89 g/mol. Its IUPAC name is [4-[3-[(4-tert-butylphenyl)-methyl-phenyl-λ4-sulfanyl]phenyl]-8-(2,2-difluoropropanoyloxy)octyl] 5-methyl-2-methyliodanuidylhexanoate.
| Compound Name | [4-[3-[(4-tert-butylphenyl)-methyl-phenyl-λ4-sulfanyl]phenyl]-8-(2,2-difluoropropanoyloxy)octyl] 5-methyl-2-methyliodanuidylhexanoate |
|---|---|
| PubChem CID | 163953903 |
| Molecular Formula | C42H58F2IO4S- |
| Molecular Weight | 823.89 g/mol |
| Exact Mass | 823.31 |
| IUPAC Name | [4-[3-[(4-tert-butylphenyl)-methyl-phenyl-λ4-sulfanyl]phenyl]-8-(2,2-difluoropropanoyloxy)octyl] 5-methyl-2-methyliodanuidylhexanoate |
| SMILES | C[I-]C(CCC(C)C)C(=O)OCCCC(CCCCOC(=O)C(C)(F)F)c1cccc(S(C)(c2ccccc2)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C42H58F2IO4S/c1-31(2)22-27-38(45-7)39(46)48-29-15-18-32(16-12-13-28-49-40(47)42(6,43)44)33-17-14-21-37(30-33)50(8,35-19-10-9-11-20-35)36-25-23-34(24-26-36)41(3,4)5/h9-11,14,17,19-21,23-26,30-32,38H,12-13,15-16,18,22,27-29H2,1-8H3/q-1 |
| InChIKey | SWBCWTHZCCTMJE-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.89 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|