About 7-[(Z)-but-2-enyl]-1,4-dihydroquinoline
7-[(Z)-but-2-enyl]-1,4-dihydroquinoline (PubChem CID 163954750) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is 7-[(Z)-but-2-enyl]-1,4-dihydroquinoline.
Molecular Properties
| Compound Name | 7-[(Z)-but-2-enyl]-1,4-dihydroquinoline |
| PubChem CID | 163954750 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 7-[(Z)-but-2-enyl]-1,4-dihydroquinoline |
| SMILES | C/C=C\Cc1ccc2c(c1)NC=CC2 |
| InChI | InChI=1S/C13H15N/c1-2-3-5-11-7-8-12-6-4-9-14-13(12)10-11/h2-4,7-10,14H,5-6H2,1H3/b3-2- |
| InChIKey | SCJWWINTWLQVEV-IHWYPQMZSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(Z)-but-2-enyl]-1,4-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(Z)-but-2-enyl]-1,4-dihydroquinoline?
The IUPAC name of 7-[(Z)-but-2-enyl]-1,4-dihydroquinoline (CID 163954750) is 7-[(Z)-but-2-enyl]-1,4-dihydroquinoline.
What is the SMILES notation for 7-[(Z)-but-2-enyl]-1,4-dihydroquinoline?
The canonical SMILES for 7-[(Z)-but-2-enyl]-1,4-dihydroquinoline is C/C=C\Cc1ccc2c(c1)NC=CC2.
What is the InChIKey of 7-[(Z)-but-2-enyl]-1,4-dihydroquinoline?
The InChIKey is SCJWWINTWLQVEV-IHWYPQMZSA-N. The full InChI is InChI=1S/C13H15N/c1-2-3-5-11-7-8-12-6-4-9-14-13(12)10-11/h2-4,7-10,14H,5-6H2,1H3/b3-2-.
What are the key properties of 7-[(Z)-but-2-enyl]-1,4-dihydroquinoline?
7-[(Z)-but-2-enyl]-1,4-dihydroquinoline has a molecular weight of 185.27 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(Z)-but-2-enyl]-1,4-dihydroquinoline is sourced from PubChem (CID 163954750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).