About CID 163955972
CID 163955972 (PubChem CID 163955972) has the molecular formula C15H19BClN2O
and a molecular weight of 289.59 g/mol.
Molecular Properties
| Compound Name | CID 163955972 |
| PubChem CID | 163955972 |
| Molecular Formula | C15H19BClN2O |
| Molecular Weight | 289.59 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | — |
| SMILES | C=CCCCc1nc2c(c(=O)n1CCCC)C=C(Cl)[B]2 |
| InChI | InChI=1S/C15H19BClN2O/c1-3-5-7-8-13-18-14-11(10-12(17)16-14)15(20)19(13)9-6-4-2/h3,10H,1,4-9H2,2H3 |
| InChIKey | UVNIODMMIBYUKD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.59 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 163955972 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163955972?
The IUPAC name of CID 163955972 (CID 163955972) is not available.
What is the SMILES notation for CID 163955972?
The canonical SMILES for CID 163955972 is C=CCCCc1nc2c(c(=O)n1CCCC)C=C(Cl)[B]2.
What is the InChIKey of CID 163955972?
The InChIKey is UVNIODMMIBYUKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BClN2O/c1-3-5-7-8-13-18-14-11(10-12(17)16-14)15(20)19(13)9-6-4-2/h3,10H,1,4-9H2,2H3.
What are the key properties of CID 163955972?
CID 163955972 has a molecular weight of 289.59 g/mol, XLogP of 2.43, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163955972 is sourced from PubChem (CID 163955972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).