C19H34N4 — CID 163956979
3-[(6E)-7-(3-iminobutan-2-ylideneamino)-2,6-dimethylocta-2,6-dien-3-yl]imino-N-methylbutan-2-amine (PubChem CID 163956979) has the molecular formula C19H34N4 and a molecular weight of 318.51 g/mol. Its IUPAC name is 3-[(6E)-7-(3-iminobutan-2-ylideneamino)-2,6-dimethylocta-2,6-dien-3-yl]imino-N-methylbutan-2-amine.
| Compound Name | 3-[(6E)-7-(3-iminobutan-2-ylideneamino)-2,6-dimethylocta-2,6-dien-3-yl]imino-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 163956979 |
| Molecular Formula | C19H34N4 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | 3-[(6E)-7-(3-iminobutan-2-ylideneamino)-2,6-dimethylocta-2,6-dien-3-yl]imino-N-methylbutan-2-amine |
| SMILES | [H]/N=C(C)/C(C)=N/C(C)=C(\C)CCC(/N=C(\C)C(C)NC)=C(C)C |
| InChI | InChI=1S/C19H34N4/c1-12(2)19(23-18(8)17(7)21-9)11-10-13(3)15(5)22-16(6)14(4)20/h17,20-21H,10-11H2,1-9H3/b15-13+,20-14+,22-16+,23-18+ |
| InChIKey | SEFKJUHIXGQLJN-BSYQUKJISA-N |
| XLogP | 4.92 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|