C17H14N3+ — CID 163957773
5,6-dimethyl-3,9-diaza-5-azoniatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2(7),3,5,8,10,12,14,16-nonaene (PubChem CID 163957773) has the molecular formula C17H14N3+ and a molecular weight of 260.32 g/mol. Its IUPAC name is 5,6-dimethyl-3,9-diaza-5-azoniatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2(7),3,5,8,10,12,14,16-nonaene.
| Compound Name | 5,6-dimethyl-3,9-diaza-5-azoniatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2(7),3,5,8,10,12,14,16-nonaene |
|---|---|
| PubChem CID | 163957773 |
| Molecular Formula | C17H14N3+ |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 5,6-dimethyl-3,9-diaza-5-azoniatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2(7),3,5,8,10,12,14,16-nonaene |
| SMILES | Cc1c2cnc3cc4ccccc4cc3c2nc[n+]1C |
| InChI | InChI=1S/C17H14N3/c1-11-15-9-18-16-8-13-6-4-3-5-12(13)7-14(16)17(15)19-10-20(11)2/h3-10H,1-2H3/q+1 |
| InChIKey | OEIMTUUUUXHOAA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|