C15H20O — CID 163958533
1,2,4-trimethyl-3-[(2E)-3-methylpenta-2,4-dien-2-yl]oxybenzene (PubChem CID 163958533) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 1,2,4-trimethyl-3-[(2E)-3-methylpenta-2,4-dien-2-yl]oxybenzene.
| Compound Name | 1,2,4-trimethyl-3-[(2E)-3-methylpenta-2,4-dien-2-yl]oxybenzene |
|---|---|
| PubChem CID | 163958533 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1,2,4-trimethyl-3-[(2E)-3-methylpenta-2,4-dien-2-yl]oxybenzene |
| SMILES | C=C/C(C)=C(\C)Oc1c(C)ccc(C)c1C |
| InChI | InChI=1S/C15H20O/c1-7-10(2)14(6)16-15-12(4)9-8-11(3)13(15)5/h7-9H,1H2,2-6H3/b14-10+ |
| InChIKey | SFMUKDZAAWTELK-GXDHUFHOSA-N |
| XLogP | 4.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|