C9H11NO — CID 163958560
4-imino-2,3,6-trimethylcyclohexa-2,5-dien-1-one (PubChem CID 163958560) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 4-imino-2,3,6-trimethylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-imino-2,3,6-trimethylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 163958560 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 4-imino-2,3,6-trimethylcyclohexa-2,5-dien-1-one |
| SMILES | [H]/N=C1\C=C(C)C(=O)C(C)=C1C |
| InChI | InChI=1S/C9H11NO/c1-5-4-8(10)6(2)7(3)9(5)11/h4,10H,1-3H3/b10-8+ |
| InChIKey | SFNJFKXAEMCVAA-CSKARUKUSA-N |
| XLogP | 1.87 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|