C14H18N2O4 — CID 163958831
2-(2,4-dioxo-6,7-dihydro-1H-quinazolin-3-yl)-3-methylpentanoic acid (PubChem CID 163958831) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-(2,4-dioxo-6,7-dihydro-1H-quinazolin-3-yl)-3-methylpentanoic acid.
| Compound Name | 2-(2,4-dioxo-6,7-dihydro-1H-quinazolin-3-yl)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 163958831 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-(2,4-dioxo-6,7-dihydro-1H-quinazolin-3-yl)-3-methylpentanoic acid |
| SMILES | CCC(C)C(C(=O)O)n1c(=O)[nH]c2c(c1=O)=CCCC=2 |
| InChI | InChI=1S/C14H18N2O4/c1-3-8(2)11(13(18)19)16-12(17)9-6-4-5-7-10(9)15-14(16)20/h6-8,11H,3-5H2,1-2H3,(H,15,20)(H,18,19) |
| InChIKey | SFRXEIBADVKAGI-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |