C20H15BF2O3 — CID 163959140
5-cyclohexa-1,5-dien-1-yl-2-(3,5-difluorophenyl)-5-phenyl-1,3,2-dioxaborolan-4-one (PubChem CID 163959140) has the molecular formula C20H15BF2O3 and a molecular weight of 352.15 g/mol. Its IUPAC name is 5-cyclohexa-1,5-dien-1-yl-2-(3,5-difluorophenyl)-5-phenyl-1,3,2-dioxaborolan-4-one.
| Compound Name | 5-cyclohexa-1,5-dien-1-yl-2-(3,5-difluorophenyl)-5-phenyl-1,3,2-dioxaborolan-4-one |
|---|---|
| PubChem CID | 163959140 |
| Molecular Formula | C20H15BF2O3 |
| Molecular Weight | 352.15 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 5-cyclohexa-1,5-dien-1-yl-2-(3,5-difluorophenyl)-5-phenyl-1,3,2-dioxaborolan-4-one |
| SMILES | O=C1OB(c2cc(F)cc(F)c2)OC1(C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C20H15BF2O3/c22-17-11-16(12-18(23)13-17)21-25-19(24)20(26-21,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1,3-5,7-13H,2,6H2 |
| InChIKey | SFYVQRNJOVTTMC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.15 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|