C21H16N4 — CID 163959365
4-(3,5-diphenylphenyl)-1,3,5-triazin-2-amine (PubChem CID 163959365) has the molecular formula C21H16N4 and a molecular weight of 324.39 g/mol. Its IUPAC name is 4-(3,5-diphenylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(3,5-diphenylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 163959365 |
| Molecular Formula | C21H16N4 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 4-(3,5-diphenylphenyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1ncnc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C21H16N4/c22-21-24-14-23-20(25-21)19-12-17(15-7-3-1-4-8-15)11-18(13-19)16-9-5-2-6-10-16/h1-14H,(H2,22,23,24,25) |
| InChIKey | SGEFJNFLAGCJIH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |