C20H21ClFN3O5S — CID 163960238
(1R,2R,4R)-4-(3-chloro-4-fluorophenyl)sulfinylcarbonyl-N-(cyanomethyl)-2-(morpholine-4-carbonyl)cyclopentane-1-carboxamide (PubChem CID 163960238) has the molecular formula C20H21ClFN3O5S and a molecular weight of 469.92 g/mol. Its IUPAC name is (1R,2R,4R)-4-(3-chloro-4-fluorophenyl)sulfinylcarbonyl-N-(cyanomethyl)-2-(morpholine-4-carbonyl)cyclopentane-1-carboxamide.
| Compound Name | (1R,2R,4R)-4-(3-chloro-4-fluorophenyl)sulfinylcarbonyl-N-(cyanomethyl)-2-(morpholine-4-carbonyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 163960238 |
| Molecular Formula | C20H21ClFN3O5S |
| Molecular Weight | 469.92 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | (1R,2R,4R)-4-(3-chloro-4-fluorophenyl)sulfinylcarbonyl-N-(cyanomethyl)-2-(morpholine-4-carbonyl)cyclopentane-1-carboxamide |
| SMILES | N#CCNC(=O)[C@@H]1C[C@@H](C(=O)S(=O)c2ccc(F)c(Cl)c2)C[C@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H21ClFN3O5S/c21-16-11-13(1-2-17(16)22)31(29)20(28)12-9-14(18(26)24-4-3-23)15(10-12)19(27)25-5-7-30-8-6-25/h1-2,11-12,14-15H,4-10H2,(H,24,26)/t12-,14-,15-,31?/m1/s1 |
| InChIKey | SGUXBYDVJUJVKP-XAZMFPEQSA-N |
| XLogP | 1.25 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.92 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|