About 3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole
3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole (PubChem CID 163961101) has the molecular formula C15H12BrN3
and a molecular weight of 314.19 g/mol. Its IUPAC name is 3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole |
| PubChem CID | 163961101 |
| Molecular Formula | C15H12BrN3 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole |
| SMILES | BrC1=CCCC(n2ccn3c4ccccc4nc23)=C1 |
| InChI | InChI=1S/C15H12BrN3/c16-11-4-3-5-12(10-11)18-8-9-19-14-7-2-1-6-13(14)17-15(18)19/h1-2,4,6-10H,3,5H2 |
| InChIKey | SHNLMRQGEBKKIG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole?
The IUPAC name of 3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole (CID 163961101) is 3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole.
What is the SMILES notation for 3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole?
The canonical SMILES for 3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole is BrC1=CCCC(n2ccn3c4ccccc4nc23)=C1.
What is the InChIKey of 3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole?
The InChIKey is SHNLMRQGEBKKIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrN3/c16-11-4-3-5-12(10-11)18-8-9-19-14-7-2-1-6-13(14)17-15(18)19/h1-2,4,6-10H,3,5H2.
What are the key properties of 3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole?
3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole has a molecular weight of 314.19 g/mol, XLogP of 4.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromocyclohexa-1,3-dien-1-yl)imidazo[1,2-a]benzimidazole is sourced from PubChem (CID 163961101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).