C22H40 — CID 163961288
7-cyclopentyl-7-ethyl-6,8,9-trimethyl-2,3,4,4a,5,6,8,9,10,10a-decahydro-1H-benzo[8]annulene (PubChem CID 163961288) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is 7-cyclopentyl-7-ethyl-6,8,9-trimethyl-2,3,4,4a,5,6,8,9,10,10a-decahydro-1H-benzo[8]annulene.
| Compound Name | 7-cyclopentyl-7-ethyl-6,8,9-trimethyl-2,3,4,4a,5,6,8,9,10,10a-decahydro-1H-benzo[8]annulene |
|---|---|
| PubChem CID | 163961288 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | 7-cyclopentyl-7-ethyl-6,8,9-trimethyl-2,3,4,4a,5,6,8,9,10,10a-decahydro-1H-benzo[8]annulene |
| SMILES | CCC1(C2CCCC2)C(C)CC2CCCCC2CC(C)C1C |
| InChI | InChI=1S/C22H40/c1-5-22(21-12-8-9-13-21)17(3)15-20-11-7-6-10-19(20)14-16(2)18(22)4/h16-21H,5-15H2,1-4H3 |
| InChIKey | SHRLCNMCQLOVIX-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |