C10H15N4+ — CID 163961552
4-(1-methylaziridin-1-ium-1-yl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (PubChem CID 163961552) has the molecular formula C10H15N4+ and a molecular weight of 191.26 g/mol. Its IUPAC name is 4-(1-methylaziridin-1-ium-1-yl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
| Compound Name | 4-(1-methylaziridin-1-ium-1-yl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 163961552 |
| Molecular Formula | C10H15N4+ |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-(1-methylaziridin-1-ium-1-yl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| SMILES | C[N+]1(c2ncnc3c2CNCC3)CC1 |
| InChI | InChI=1S/C10H15N4/c1-14(4-5-14)10-8-6-11-3-2-9(8)12-7-13-10/h7,11H,2-6H2,1H3/q+1 |
| InChIKey | WYNJMCRBPCDWJC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|