About 1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+)
1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+) (PubChem CID 163961870) has the molecular formula C19H20FN3U
and a molecular weight of 547.42 g/mol. Its IUPAC name is 1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+).
Molecular Properties
| Compound Name | 1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+) |
| PubChem CID | 163961870 |
| Molecular Formula | C19H20FN3U |
| Molecular Weight | 547.42 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+) |
| SMILES | CCN1CCN(/C(=N/c2[c-]ccc(F)c2)c2[c-]cccc2)CC1.[U+2] |
| InChI | InChI=1S/C19H20FN3.U/c1-2-22-11-13-23(14-12-22)19(16-7-4-3-5-8-16)21-18-10-6-9-17(20)15-18;/h3-7,9,15H,2,11-14H2,1H3;/q-2;+2/b21-19+; |
| InChIKey | IVCLGRDGQHBOFG-UXJRWBAGSA-N |
| XLogP | 3.14 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 547.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+)?
The IUPAC name of 1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+) (CID 163961870) is 1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+).
What is the SMILES notation for 1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+)?
The canonical SMILES for 1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+) is CCN1CCN(/C(=N/c2[c-]ccc(F)c2)c2[c-]cccc2)CC1.[U+2].
What is the InChIKey of 1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+)?
The InChIKey is IVCLGRDGQHBOFG-UXJRWBAGSA-N. The full InChI is InChI=1S/C19H20FN3.U/c1-2-22-11-13-23(14-12-22)19(16-7-4-3-5-8-16)21-18-10-6-9-17(20)15-18;/h3-7,9,15H,2,11-14H2,1H3;/q-2;+2/b21-19+;.
What are the key properties of 1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+)?
1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+) has a molecular weight of 547.42 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylpiperazin-1-yl)-N-(3-fluorobenzene-6-id-1-yl)-1-phenylmethanimine;uranium(2+) is sourced from PubChem (CID 163961870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).