C45H27N3OU — CID 163962459
2-dibenzofuran-3-yl-4-(3,5-diphenylphenyl)-6-(4-phenylbenzene-5-id-1-yl)-1,3,5-triazine;uranium(2+) (PubChem CID 163962459) has the molecular formula C45H27N3OU and a molecular weight of 863.76 g/mol. Its IUPAC name is 2-dibenzofuran-3-yl-4-(3,5-diphenylphenyl)-6-(4-phenylbenzene-5-id-1-yl)-1,3,5-triazine;uranium(2+).
| Compound Name | 2-dibenzofuran-3-yl-4-(3,5-diphenylphenyl)-6-(4-phenylbenzene-5-id-1-yl)-1,3,5-triazine;uranium(2+) |
|---|---|
| PubChem CID | 163962459 |
| Molecular Formula | C45H27N3OU |
| Molecular Weight | 863.76 g/mol |
| Exact Mass | 863.27 |
| IUPAC Name | 2-dibenzofuran-3-yl-4-(3,5-diphenylphenyl)-6-(4-phenylbenzene-5-id-1-yl)-1,3,5-triazine;uranium(2+) |
| SMILES | [U+2].[c-]1ccccc1-c1[c-]cc(-c2nc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)nc(-c3ccc4c(c3)oc3ccccc34)n2)cc1 |
| InChI | InChI=1S/C45H27N3O.U/c1-4-12-30(13-5-1)33-20-22-34(23-21-33)43-46-44(35-24-25-40-39-18-10-11-19-41(39)49-42(40)29-35)48-45(47-43)38-27-36(31-14-6-2-7-15-31)26-37(28-38)32-16-8-3-9-17-32;/h1-12,14-20,22-29H;/q-2;+2 |
| InChIKey | HGRGWTVHFTWWIB-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.76 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|