About 5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol
5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol (PubChem CID 163962547) has the molecular formula C10H14O3S2
and a molecular weight of 246.35 g/mol. Its IUPAC name is 5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol.
Molecular Properties
| Compound Name | 5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol |
| PubChem CID | 163962547 |
| Molecular Formula | C10H14O3S2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol |
| SMILES | C=CSC1=C(C)C(O)CC2(CC2)S1(=O)=O |
| InChI | InChI=1S/C10H14O3S2/c1-3-14-9-7(2)8(11)6-10(4-5-10)15(9,12)13/h3,8,11H,1,4-6H2,2H3 |
| InChIKey | SIUKQBCWBNIBQW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol?
The IUPAC name of 5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol (CID 163962547) is 5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol.
What is the SMILES notation for 5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol?
The canonical SMILES for 5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol is C=CSC1=C(C)C(O)CC2(CC2)S1(=O)=O.
What is the InChIKey of 5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol?
The InChIKey is SIUKQBCWBNIBQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3S2/c1-3-14-9-7(2)8(11)6-10(4-5-10)15(9,12)13/h3,8,11H,1,4-6H2,2H3.
What are the key properties of 5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol?
5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol has a molecular weight of 246.35 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenylsulfanyl-6-methyl-4,4-dioxo-4λ6-thiaspiro[2.5]oct-5-en-7-ol is sourced from PubChem (CID 163962547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).