About 2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde
2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde (PubChem CID 163963136) has the molecular formula C6H8FNO
and a molecular weight of 129.13 g/mol. Its IUPAC name is 2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde |
| PubChem CID | 163963136 |
| Molecular Formula | C6H8FNO |
| Molecular Weight | 129.13 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde |
| SMILES | O=CCC1=CC(F)NC1 |
| InChI | InChI=1S/C6H8FNO/c7-6-3-5(1-2-9)4-8-6/h2-3,6,8H,1,4H2 |
| InChIKey | SJGHRHVKQXMLMQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.13 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde?
The IUPAC name of 2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde (CID 163963136) is 2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde.
What is the SMILES notation for 2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde?
The canonical SMILES for 2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde is O=CCC1=CC(F)NC1.
What is the InChIKey of 2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde?
The InChIKey is SJGHRHVKQXMLMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8FNO/c7-6-3-5(1-2-9)4-8-6/h2-3,6,8H,1,4H2.
What are the key properties of 2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde?
2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde has a molecular weight of 129.13 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-fluoro-2,5-dihydro-1H-pyrrol-3-yl)acetaldehyde is sourced from PubChem (CID 163963136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).